C25H31NO2Si — CID 67559581
2-[2-[diethoxy(methyl)silyl]ethyl]-N,N-diphenylaniline (PubChem CID 67559581) has the molecular formula C25H31NO2Si and a molecular weight of 405.61 g/mol. Its IUPAC name is 2-[2-[diethoxy(methyl)silyl]ethyl]-N,N-diphenylaniline.
| Compound Name | 2-[2-[diethoxy(methyl)silyl]ethyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 67559581 |
| Molecular Formula | C25H31NO2Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[2-[diethoxy(methyl)silyl]ethyl]-N,N-diphenylaniline |
| SMILES | CCO[Si](C)(CCc1ccccc1N(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C25H31NO2Si/c1-4-27-29(3,28-5-2)21-20-22-14-12-13-19-25(22)26(23-15-8-6-9-16-23)24-17-10-7-11-18-24/h6-19H,4-5,20-21H2,1-3H3 |
| InChIKey | YMQOIZYRILWISQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|