C22H18N2O2S — CID 152709778
[3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]sulfanylmethyl cyclobutanecarboxylate (PubChem CID 152709778) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is [3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]sulfanylmethyl cyclobutanecarboxylate.
| Compound Name | [3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]sulfanylmethyl cyclobutanecarboxylate |
|---|---|
| PubChem CID | 152709778 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [3-(4-cyanonaphthalen-1-yl)-4-pyridinyl]sulfanylmethyl cyclobutanecarboxylate |
| SMILES | N#Cc1ccc(-c2cnccc2SCOC(=O)C2CCC2)c2ccccc12 |
| InChI | InChI=1S/C22H18N2O2S/c23-12-16-8-9-19(18-7-2-1-6-17(16)18)20-13-24-11-10-21(20)27-14-26-22(25)15-4-3-5-15/h1-2,6-11,13,15H,3-5,14H2 |
| InChIKey | ZTIYHNOTQBGSEM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|