About S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate
S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate (PubChem CID 175156957) has the molecular formula C19H14ClN3OS
and a molecular weight of 367.86 g/mol. Its IUPAC name is S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate.
Molecular Properties
| Compound Name | S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate |
| PubChem CID | 175156957 |
| Molecular Formula | C19H14ClN3OS |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate |
| SMILES | N#Cc1ccc(-c2cnccc2SC(=O)C2CCC2)n2cc(Cl)cc12 |
| InChI | InChI=1S/C19H14ClN3OS/c20-14-8-17-13(9-21)4-5-16(23(17)11-14)15-10-22-7-6-18(15)25-19(24)12-2-1-3-12/h4-8,10-12H,1-3H2 |
| InChIKey | OBFADDSZAHYTTR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate?
The IUPAC name of S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate (CID 175156957) is S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate.
What is the SMILES notation for S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate?
The canonical SMILES for S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate is N#Cc1ccc(-c2cnccc2SC(=O)C2CCC2)n2cc(Cl)cc12.
What is the InChIKey of S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate?
The InChIKey is OBFADDSZAHYTTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3OS/c20-14-8-17-13(9-21)4-5-16(23(17)11-14)15-10-22-7-6-18(15)25-19(24)12-2-1-3-12/h4-8,10-12H,1-3H2.
What are the key properties of S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate?
S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate has a molecular weight of 367.86 g/mol, XLogP of 4.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-(2-chloro-8-cyanoindolizin-5-yl)-4-pyridinyl] cyclobutanecarbothioate is sourced from PubChem (CID 175156957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).