About 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one
3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one (PubChem CID 15272957) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one.
Analyze 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one?
The IUPAC name of 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one (CID 15272957) is 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one is CC1SCC(=O)N1CCCO.
What is the InChIKey of 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one?
The InChIKey is NWGPVKAKWOHYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-6-8(3-2-4-9)7(10)5-11-6/h6,9H,2-5H2,1H3.
What are the key properties of 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one?
3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one has a molecular weight of 175.25 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxypropyl)-2-methyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 15272957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).