C29H32N6OSi — CID 152732821
2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tetrazol-5-yl]-1-(naphthalen-1-ylmethyl)indole-6-carbonitrile (PubChem CID 152732821) has the molecular formula C29H32N6OSi and a molecular weight of 508.70 g/mol. Its IUPAC name is 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tetrazol-5-yl]-1-(naphthalen-1-ylmethyl)indole-6-carbonitrile.
| Compound Name | 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tetrazol-5-yl]-1-(naphthalen-1-ylmethyl)indole-6-carbonitrile |
|---|---|
| PubChem CID | 152732821 |
| Molecular Formula | C29H32N6OSi |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tetrazol-5-yl]-1-(naphthalen-1-ylmethyl)indole-6-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1nnnc1-c1cc2ccc(C#N)cc2n1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C29H32N6OSi/c1-29(2,3)37(4,5)36-16-15-35-28(31-32-33-35)27-18-23-14-13-21(19-30)17-26(23)34(27)20-24-11-8-10-22-9-6-7-12-25(22)24/h6-14,17-18H,15-16,20H2,1-5H3 |
| InChIKey | ZXZFAWLIMGTPSL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 81.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|