C21H15N3O2 — CID 146459969
[6-cyano-1-(naphthalen-1-ylmethyl)indol-2-yl]carbamic acid (PubChem CID 146459969) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is [6-cyano-1-(naphthalen-1-ylmethyl)indol-2-yl]carbamic acid.
| Compound Name | [6-cyano-1-(naphthalen-1-ylmethyl)indol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146459969 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [6-cyano-1-(naphthalen-1-ylmethyl)indol-2-yl]carbamic acid |
| SMILES | N#Cc1ccc2cc(NC(=O)O)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C21H15N3O2/c22-12-14-8-9-16-11-20(23-21(25)26)24(19(16)10-14)13-17-6-3-5-15-4-1-2-7-18(15)17/h1-11,23H,13H2,(H,25,26) |
| InChIKey | GSJRGDFIZCQZRY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |