C24H20ClFO2 — CID 152746808
1-[1-(4-chlorophenyl)cycloprop-2-en-1-yl]-3-(4-fluoro-3-phenoxyphenyl)propan-2-ol (PubChem CID 152746808) has the molecular formula C24H20ClFO2 and a molecular weight of 394.87 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cycloprop-2-en-1-yl]-3-(4-fluoro-3-phenoxyphenyl)propan-2-ol.
| Compound Name | 1-[1-(4-chlorophenyl)cycloprop-2-en-1-yl]-3-(4-fluoro-3-phenoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 152746808 |
| Molecular Formula | C24H20ClFO2 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cycloprop-2-en-1-yl]-3-(4-fluoro-3-phenoxyphenyl)propan-2-ol |
| SMILES | OC(Cc1ccc(F)c(Oc2ccccc2)c1)CC1(c2ccc(Cl)cc2)C=C1 |
| InChI | InChI=1S/C24H20ClFO2/c25-19-9-7-18(8-10-19)24(12-13-24)16-20(27)14-17-6-11-22(26)23(15-17)28-21-4-2-1-3-5-21/h1-13,15,20,27H,14,16H2 |
| InChIKey | JVZXPQVAZLJVAF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|