C19H18F2O2 — CID 141024524
4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol (PubChem CID 141024524) has the molecular formula C19H18F2O2 and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol.
| Compound Name | 4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 141024524 |
| Molecular Formula | C19H18F2O2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol |
| SMILES | OC(Cc1ccc(F)c(Oc2ccccc2)c1)C(F)=CC1CC1 |
| InChI | InChI=1S/C19H18F2O2/c20-16-9-8-14(11-18(22)17(21)10-13-6-7-13)12-19(16)23-15-4-2-1-3-5-15/h1-5,8-10,12-13,18,22H,6-7,11H2 |
| InChIKey | RZNHDVJRUFNIOH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |