C20H20F2O4 — CID 70013522
cyclopropyl 2-fluoro-4-(4-fluoro-3-phenoxyphenyl)-3-hydroxy-2-methylbutanoate (PubChem CID 70013522) has the molecular formula C20H20F2O4 and a molecular weight of 362.37 g/mol. Its IUPAC name is cyclopropyl 2-fluoro-4-(4-fluoro-3-phenoxyphenyl)-3-hydroxy-2-methylbutanoate.
| Compound Name | cyclopropyl 2-fluoro-4-(4-fluoro-3-phenoxyphenyl)-3-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 70013522 |
| Molecular Formula | C20H20F2O4 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | cyclopropyl 2-fluoro-4-(4-fluoro-3-phenoxyphenyl)-3-hydroxy-2-methylbutanoate |
| SMILES | CC(F)(C(=O)OC1CC1)C(O)Cc1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H20F2O4/c1-20(22,19(24)26-15-8-9-15)18(23)12-13-7-10-16(21)17(11-13)25-14-5-3-2-4-6-14/h2-7,10-11,15,18,23H,8-9,12H2,1H3 |
| InChIKey | JLFRYTMZVIARNK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |