C25H21ClF2O2 — CID 54171440
4-(4-chlorophenyl)-4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol (PubChem CID 54171440) has the molecular formula C25H21ClF2O2 and a molecular weight of 426.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol.
| Compound Name | 4-(4-chlorophenyl)-4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 54171440 |
| Molecular Formula | C25H21ClF2O2 |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-(4-chlorophenyl)-4-cyclopropyl-3-fluoro-1-(4-fluoro-3-phenoxyphenyl)but-3-en-2-ol |
| SMILES | OC(Cc1ccc(F)c(Oc2ccccc2)c1)C(F)=C(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C25H21ClF2O2/c26-19-11-9-18(10-12-19)24(17-7-8-17)25(28)22(29)14-16-6-13-21(27)23(15-16)30-20-4-2-1-3-5-20/h1-6,9-13,15,17,22,29H,7-8,14H2 |
| InChIKey | OVHYIAVWHNQHSS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |