C12H19NO4S — CID 152748393
1-cyclopentyloxy-4-methoxycyclohexa-2,4-diene-1-sulfonamide (PubChem CID 152748393) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 1-cyclopentyloxy-4-methoxycyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 1-cyclopentyloxy-4-methoxycyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 152748393 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-cyclopentyloxy-4-methoxycyclohexa-2,4-diene-1-sulfonamide |
| SMILES | COC1=CCC(OC2CCCC2)(S(N)(=O)=O)C=C1 |
| InChI | InChI=1S/C12H19NO4S/c1-16-10-6-8-12(9-7-10,18(13,14)15)17-11-4-2-3-5-11/h6-8,11H,2-5,9H2,1H3,(H2,13,14,15) |
| InChIKey | VMWVRVIEKLFYEB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |