C9H15NO4S — CID 90345167
2,6-dimethoxy-1-methylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 90345167) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2,6-dimethoxy-1-methylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 2,6-dimethoxy-1-methylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 90345167 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,6-dimethoxy-1-methylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | COC1=CC=CC(OC)C1(C)S(N)(=O)=O |
| InChI | InChI=1S/C9H15NO4S/c1-9(15(10,11)12)7(13-2)5-4-6-8(9)14-3/h4-7H,1-3H3,(H2,10,11,12) |
| InChIKey | WZIMBSOQLNGARD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |