About N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide
N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide (PubChem CID 135211707) has the molecular formula C9H11NO5S
and a molecular weight of 245.26 g/mol. Its IUPAC name is N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide.
Molecular Properties
| Compound Name | N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide |
| PubChem CID | 135211707 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide |
| SMILES | COC1=CC2OC(S(=O)(=O)NO)=CC2C=C1 |
| InChI | InChI=1S/C9H11NO5S/c1-14-7-3-2-6-4-9(15-8(6)5-7)16(12,13)10-11/h2-6,8,10-11H,1H3 |
| InChIKey | WHUMHXBXHBWULQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide?
The IUPAC name of N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide (CID 135211707) is N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide.
What is the SMILES notation for N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide?
The canonical SMILES for N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide is COC1=CC2OC(S(=O)(=O)NO)=CC2C=C1.
What is the InChIKey of N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide?
The InChIKey is WHUMHXBXHBWULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S/c1-14-7-3-2-6-4-9(15-8(6)5-7)16(12,13)10-11/h2-6,8,10-11H,1H3.
What are the key properties of N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide?
N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide has a molecular weight of 245.26 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-6-methoxy-3a,7a-dihydro-1-benzofuran-2-sulfonamide is sourced from PubChem (CID 135211707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).