About (2-chlorophenyl) thiohypofluorite
(2-chlorophenyl) thiohypofluorite (PubChem CID 152757433) has the molecular formula C6H4ClFS
and a molecular weight of 162.62 g/mol. Its IUPAC name is (2-chlorophenyl) thiohypofluorite.
Molecular Properties
| Compound Name | (2-chlorophenyl) thiohypofluorite |
| PubChem CID | 152757433 |
| Molecular Formula | C6H4ClFS |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | (2-chlorophenyl) thiohypofluorite |
| SMILES | FSc1ccccc1Cl |
| InChI | InChI=1S/C6H4ClFS/c7-5-3-1-2-4-6(5)9-8/h1-4H |
| InChIKey | HIURURLAOOFQAJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-chlorophenyl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) thiohypofluorite?
The IUPAC name of (2-chlorophenyl) thiohypofluorite (CID 152757433) is (2-chlorophenyl) thiohypofluorite.
What is the SMILES notation for (2-chlorophenyl) thiohypofluorite?
The canonical SMILES for (2-chlorophenyl) thiohypofluorite is FSc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl) thiohypofluorite?
The InChIKey is HIURURLAOOFQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClFS/c7-5-3-1-2-4-6(5)9-8/h1-4H.
What are the key properties of (2-chlorophenyl) thiohypofluorite?
(2-chlorophenyl) thiohypofluorite has a molecular weight of 162.62 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) thiohypofluorite is sourced from PubChem (CID 152757433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).