About 2-ethynylpiperazine-1,4-dicarboxylic acid
2-ethynylpiperazine-1,4-dicarboxylic acid (PubChem CID 152758441) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-ethynylpiperazine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-ethynylpiperazine-1,4-dicarboxylic acid |
| PubChem CID | 152758441 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-ethynylpiperazine-1,4-dicarboxylic acid |
| SMILES | C#CC1CN(C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C8H10N2O4/c1-2-6-5-9(7(11)12)3-4-10(6)8(13)14/h1,6H,3-5H2,(H,11,12)(H,13,14) |
| InChIKey | LGUJPTVCGKXMFI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylpiperazine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylpiperazine-1,4-dicarboxylic acid?
The IUPAC name of 2-ethynylpiperazine-1,4-dicarboxylic acid (CID 152758441) is 2-ethynylpiperazine-1,4-dicarboxylic acid.
What is the SMILES notation for 2-ethynylpiperazine-1,4-dicarboxylic acid?
The canonical SMILES for 2-ethynylpiperazine-1,4-dicarboxylic acid is C#CC1CN(C(=O)O)CCN1C(=O)O.
What is the InChIKey of 2-ethynylpiperazine-1,4-dicarboxylic acid?
The InChIKey is LGUJPTVCGKXMFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-2-6-5-9(7(11)12)3-4-10(6)8(13)14/h1,6H,3-5H2,(H,11,12)(H,13,14).
What are the key properties of 2-ethynylpiperazine-1,4-dicarboxylic acid?
2-ethynylpiperazine-1,4-dicarboxylic acid has a molecular weight of 198.18 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylpiperazine-1,4-dicarboxylic acid is sourced from PubChem (CID 152758441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).