2-ethynylpiperazine-1,4-dicarboxylic acid

C8H10N2O4 — CID 152758441

IUPAC2-ethynylpiperazine-1,4-dicarboxylic acid
SMILESC#CC1CN(C(=O)O)CCN1C(=O)O
InChIInChI=1S/C8H10N2O4/c1-2-6-5-9(7(11)12)3-4-10(6)8(13)14/h1,6H,3-5H2,(H,11,12)(H,13,14)
InChIKeyLGUJPTVCGKXMFI-UHFFFAOYSA-N
MW198.18 g/mol
LogP-0.04
Rot. Bonds

About 2-ethynylpiperazine-1,4-dicarboxylic acid

2-ethynylpiperazine-1,4-dicarboxylic acid (PubChem CID 152758441) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-ethynylpiperazine-1,4-dicarboxylic acid.

Molecular Properties

Compound Name2-ethynylpiperazine-1,4-dicarboxylic acid
PubChem CID152758441
Molecular FormulaC8H10N2O4
Molecular Weight198.18 g/mol
Exact Mass198.06
IUPAC Name2-ethynylpiperazine-1,4-dicarboxylic acid
SMILESC#CC1CN(C(=O)O)CCN1C(=O)O
InChIInChI=1S/C8H10N2O4/c1-2-6-5-9(7(11)12)3-4-10(6)8(13)14/h1,6H,3-5H2,(H,11,12)(H,13,14)
InChIKeyLGUJPTVCGKXMFI-UHFFFAOYSA-N
XLogP-0.04
TPSA81.08 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 5-0.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-ethynylpiperazine-1,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethynylpiperazine-1,4-dicarboxylic acid?
The IUPAC name of 2-ethynylpiperazine-1,4-dicarboxylic acid (CID 152758441) is 2-ethynylpiperazine-1,4-dicarboxylic acid.
What is the SMILES notation for 2-ethynylpiperazine-1,4-dicarboxylic acid?
The canonical SMILES for 2-ethynylpiperazine-1,4-dicarboxylic acid is C#CC1CN(C(=O)O)CCN1C(=O)O.
What is the InChIKey of 2-ethynylpiperazine-1,4-dicarboxylic acid?
The InChIKey is LGUJPTVCGKXMFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-2-6-5-9(7(11)12)3-4-10(6)8(13)14/h1,6H,3-5H2,(H,11,12)(H,13,14).
What are the key properties of 2-ethynylpiperazine-1,4-dicarboxylic acid?
2-ethynylpiperazine-1,4-dicarboxylic acid has a molecular weight of 198.18 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylpiperazine-1,4-dicarboxylic acid is sourced from PubChem (CID 152758441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).