C13H16N4O5 — CID 22322193
2-[amino(phenyl)carbamoyl]piperazine-1,4-dicarboxylic acid (PubChem CID 22322193) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[amino(phenyl)carbamoyl]piperazine-1,4-dicarboxylic acid.
| Compound Name | 2-[amino(phenyl)carbamoyl]piperazine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 22322193 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[amino(phenyl)carbamoyl]piperazine-1,4-dicarboxylic acid |
| SMILES | NN(C(=O)C1CN(C(=O)O)CCN1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H16N4O5/c14-17(9-4-2-1-3-5-9)11(18)10-8-15(12(19)20)6-7-16(10)13(21)22/h1-5,10H,6-8,14H2,(H,19,20)(H,21,22) |
| InChIKey | DUBRAYNLGIXEHV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|