C12H11NS — CID 152758606
2,4-dihydro-[1,3]thiazino[4,3-a]isoquinoline (PubChem CID 152758606) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2,4-dihydro-[1,3]thiazino[4,3-a]isoquinoline.
| Compound Name | 2,4-dihydro-[1,3]thiazino[4,3-a]isoquinoline |
|---|---|
| PubChem CID | 152758606 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2,4-dihydro-[1,3]thiazino[4,3-a]isoquinoline |
| SMILES | C1=CN2CSCC=C2c2ccccc21 |
| InChI | InChI=1S/C12H11NS/c1-2-4-11-10(3-1)5-7-13-9-14-8-6-12(11)13/h1-7H,8-9H2 |
| InChIKey | QTEUNSBWNOLMBB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |