C37H42N2O5S — CID 152759001
N-[2-(3-methoxy-5-methyl-4-phenylmethoxyphenyl)ethyl]-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine (PubChem CID 152759001) has the molecular formula C37H42N2O5S and a molecular weight of 626.82 g/mol. Its IUPAC name is N-[2-(3-methoxy-5-methyl-4-phenylmethoxyphenyl)ethyl]-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine.
| Compound Name | N-[2-(3-methoxy-5-methyl-4-phenylmethoxyphenyl)ethyl]-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine |
|---|---|
| PubChem CID | 152759001 |
| Molecular Formula | C37H42N2O5S |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | N-[2-(3-methoxy-5-methyl-4-phenylmethoxyphenyl)ethyl]-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine |
| SMILES | COc1cc(CCNCCCOc2ccc(S(=O)(=O)c3c(C(C)C)cn4ccccc34)cc2)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C37H42N2O5S/c1-27(2)33-25-39-21-9-8-13-34(39)37(33)45(40,41)32-16-14-31(15-17-32)43-22-10-19-38-20-18-30-23-28(3)36(35(24-30)42-4)44-26-29-11-6-5-7-12-29/h5-9,11-17,21,23-25,27,38H,10,18-20,22,26H2,1-4H3 |
| InChIKey | IHHQBYPXDIEBKW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|