C28H32N6O9 — CID 152761874
dimethyl (2S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[(3-methoxy-3-oxo-1-phenylpropyl)amino]-2-oxoethyl]amino]pentanedioate (PubChem CID 152761874) has the molecular formula C28H32N6O9 and a molecular weight of 596.60 g/mol. Its IUPAC name is dimethyl (2S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[(3-methoxy-3-oxo-1-phenylpropyl)amino]-2-oxoethyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[(3-methoxy-3-oxo-1-phenylpropyl)amino]-2-oxoethyl]amino]pentanedioate |
|---|---|
| PubChem CID | 152761874 |
| Molecular Formula | C28H32N6O9 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | dimethyl (2S)-2-[(5-acetamido-2-azidobenzoyl)-[2-[(3-methoxy-3-oxo-1-phenylpropyl)amino]-2-oxoethyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)N(CC(=O)NC(CC(=O)OC)c1ccccc1)C(=O)c1cc(NC(C)=O)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C28H32N6O9/c1-17(35)30-19-10-11-21(32-33-29)20(14-19)27(39)34(23(28(40)43-4)12-13-25(37)41-2)16-24(36)31-22(15-26(38)42-3)18-8-6-5-7-9-18/h5-11,14,22-23H,12-13,15-16H2,1-4H3,(H,30,35)(H,31,36)/t22?,23-/m0/s1 |
| InChIKey | YLYBKQBWOJGWKO-WCSIJFPASA-N |
| XLogP | 2.94 |
| TPSA | 206.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|