C27H32N6O7 — CID 136654733
ethyl (3S)-3-[[2-[(5-acetamido-2-azidobenzoyl)-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]acetyl]amino]butanoate (PubChem CID 136654733) has the molecular formula C27H32N6O7 and a molecular weight of 552.59 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[(5-acetamido-2-azidobenzoyl)-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]acetyl]amino]butanoate.
| Compound Name | ethyl (3S)-3-[[2-[(5-acetamido-2-azidobenzoyl)-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 136654733 |
| Molecular Formula | C27H32N6O7 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | ethyl (3S)-3-[[2-[(5-acetamido-2-azidobenzoyl)-[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]acetyl]amino]butanoate |
| SMILES | CCOC(=O)C[C@H](C)NC(=O)CN(C(=O)c1cc(NC(C)=O)ccc1N=[N+]=[N-])[C@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C27H32N6O7/c1-5-40-25(36)13-17(2)29-24(35)16-33(23(27(38)39-4)14-19-9-7-6-8-10-19)26(37)21-15-20(30-18(3)34)11-12-22(21)31-32-28/h6-12,15,17,23H,5,13-14,16H2,1-4H3,(H,29,35)(H,30,34)/t17-,23+/m0/s1 |
| InChIKey | HWMADWMZDADVRN-GAJHUEQPSA-N |
| XLogP | 3.27 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|