C18H26ClN3 — CID 152777863
4-(7-chloroquinolin-4-yl)-4-N,4-N-diethylpentane-1,4-diamine (PubChem CID 152777863) has the molecular formula C18H26ClN3 and a molecular weight of 319.88 g/mol. Its IUPAC name is 4-(7-chloroquinolin-4-yl)-4-N,4-N-diethylpentane-1,4-diamine.
| Compound Name | 4-(7-chloroquinolin-4-yl)-4-N,4-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 152777863 |
| Molecular Formula | C18H26ClN3 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-(7-chloroquinolin-4-yl)-4-N,4-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)C(C)(CCCN)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3/c1-4-22(5-2)18(3,10-6-11-20)16-9-12-21-17-13-14(19)7-8-15(16)17/h7-9,12-13H,4-6,10-11,20H2,1-3H3 |
| InChIKey | NYIMUNOTJSROAE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |