2-sulfobenzene-1,3-dicarboxylic acid

C8H6O7S — CID 15279310

IUPAC2-sulfobenzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cccc(C(=O)O)c1S(=O)(=O)O
InChIInChI=1S/C8H6O7S/c9-7(10)4-2-1-3-5(8(11)12)6(4)16(13,14)15/h1-3H,(H,9,10)(H,11,12)(H,13,14,15)
InChIKeyYZTJKOLMWJNVFH-UHFFFAOYSA-N
MW246.20 g/mol
LogP0.33
Rot. Bonds3

About 2-sulfobenzene-1,3-dicarboxylic acid

2-sulfobenzene-1,3-dicarboxylic acid (PubChem CID 15279310) has the molecular formula C8H6O7S and a molecular weight of 246.20 g/mol. Its IUPAC name is 2-sulfobenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-sulfobenzene-1,3-dicarboxylic acid
PubChem CID15279310
Molecular FormulaC8H6O7S
Molecular Weight246.20 g/mol
Exact Mass245.98
IUPAC Name2-sulfobenzene-1,3-dicarboxylic acid
SMILESO=C(O)c1cccc(C(=O)O)c1S(=O)(=O)O
InChIInChI=1S/C8H6O7S/c9-7(10)4-2-1-3-5(8(11)12)6(4)16(13,14)15/h1-3H,(H,9,10)(H,11,12)(H,13,14,15)
InChIKeyYZTJKOLMWJNVFH-UHFFFAOYSA-N
XLogP0.33
TPSA128.97 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.20
LogP ≤ 50.33
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-sulfobenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-sulfobenzene-1,3-dicarboxylic acid?
The IUPAC name of 2-sulfobenzene-1,3-dicarboxylic acid (CID 15279310) is 2-sulfobenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-sulfobenzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-sulfobenzene-1,3-dicarboxylic acid is O=C(O)c1cccc(C(=O)O)c1S(=O)(=O)O.
What is the InChIKey of 2-sulfobenzene-1,3-dicarboxylic acid?
The InChIKey is YZTJKOLMWJNVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O7S/c9-7(10)4-2-1-3-5(8(11)12)6(4)16(13,14)15/h1-3H,(H,9,10)(H,11,12)(H,13,14,15).
What are the key properties of 2-sulfobenzene-1,3-dicarboxylic acid?
2-sulfobenzene-1,3-dicarboxylic acid has a molecular weight of 246.20 g/mol, XLogP of 0.33, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfobenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 15279310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).