C19H19FN4O3S — CID 152795036
N-[(2-fluorophenyl)methyl]-5-pyridin-2-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide (PubChem CID 152795036) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-pyridin-2-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-pyridin-2-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 152795036 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-pyridin-2-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccccc1F)N1CC2=C(C1)CN(S(=O)(=O)c1ccccn1)C2 |
| InChI | InChI=1S/C19H19FN4O3S/c20-17-6-2-1-5-14(17)9-22-19(25)23-10-15-12-24(13-16(15)11-23)28(26,27)18-7-3-4-8-21-18/h1-8H,9-13H2,(H,22,25) |
| InChIKey | SLDMKGAYSUFLIB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|