C7H17NRe-2 — CID 152810775
carbanide;3,3-dimethylbutan-2-amine;rhenium (PubChem CID 152810775) has the molecular formula C7H17NRe-2 and a molecular weight of 301.43 g/mol. Its IUPAC name is carbanide;3,3-dimethylbutan-2-amine;rhenium.
| Compound Name | carbanide;3,3-dimethylbutan-2-amine;rhenium |
|---|---|
| PubChem CID | 152810775 |
| Molecular Formula | C7H17NRe-2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | carbanide;3,3-dimethylbutan-2-amine;rhenium |
| SMILES | C[C-](N)C(C)(C)C.[CH3-].[Re] |
| InChI | InChI=1S/C6H14N.CH3.Re/c1-5(7)6(2,3)4;;/h7H2,1-4H3;1H3;/q2*-1; |
| InChIKey | HWGMYFRBTYNUQA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|