About carbanide;2-methylpropane;tungsten;tungsten(2+)
carbanide;2-methylpropane;tungsten;tungsten(2+) (PubChem CID 59522549) has the molecular formula C5H12W4
and a molecular weight of 807.51 g/mol. Its IUPAC name is carbanide;2-methylpropane;tungsten;tungsten(2+).
Molecular Properties
| Compound Name | carbanide;2-methylpropane;tungsten;tungsten(2+) |
| PubChem CID | 59522549 |
| Molecular Formula | C5H12W4 |
| Molecular Weight | 807.51 g/mol |
| Exact Mass | 807.90 |
| IUPAC Name | carbanide;2-methylpropane;tungsten;tungsten(2+) |
| SMILES | C[C-](C)C.[CH3-].[W+2].[W].[W].[W] |
| InChI | InChI=1S/C4H9.CH3.4W/c1-4(2)3;;;;;/h1-3H3;1H3;;;;/q2*-1;;;;+2 |
| InChIKey | OFAJMRMIJJCOOF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 807.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-methylpropane;tungsten;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-methylpropane;tungsten;tungsten(2+)?
The IUPAC name of carbanide;2-methylpropane;tungsten;tungsten(2+) (CID 59522549) is carbanide;2-methylpropane;tungsten;tungsten(2+).
What is the SMILES notation for carbanide;2-methylpropane;tungsten;tungsten(2+)?
The canonical SMILES for carbanide;2-methylpropane;tungsten;tungsten(2+) is C[C-](C)C.[CH3-].[W+2].[W].[W].[W].
What is the InChIKey of carbanide;2-methylpropane;tungsten;tungsten(2+)?
The InChIKey is OFAJMRMIJJCOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.CH3.4W/c1-4(2)3;;;;;/h1-3H3;1H3;;;;/q2*-1;;;;+2.
What are the key properties of carbanide;2-methylpropane;tungsten;tungsten(2+)?
carbanide;2-methylpropane;tungsten;tungsten(2+) has a molecular weight of 807.51 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-methylpropane;tungsten;tungsten(2+) is sourced from PubChem (CID 59522549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).