About sodium;2-methylpropane;hydrate
sodium;2-methylpropane;hydrate (PubChem CID 172863032) has the molecular formula C4H11NaO
and a molecular weight of 98.12 g/mol. Its IUPAC name is sodium;2-methylpropane;hydrate.
Molecular Properties
| Compound Name | sodium;2-methylpropane;hydrate |
| PubChem CID | 172863032 |
| Molecular Formula | C4H11NaO |
| Molecular Weight | 98.12 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | sodium;2-methylpropane;hydrate |
| SMILES | C[C-](C)C.O.[Na+] |
| InChI | InChI=1S/C4H9.Na.H2O/c1-4(2)3;;/h1-3H3;;1H2/q-1;+1; |
| InChIKey | YIQZXHRLCNLNKK-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.12 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methylpropane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylpropane;hydrate?
The IUPAC name of sodium;2-methylpropane;hydrate (CID 172863032) is sodium;2-methylpropane;hydrate.
What is the SMILES notation for sodium;2-methylpropane;hydrate?
The canonical SMILES for sodium;2-methylpropane;hydrate is C[C-](C)C.O.[Na+].
What is the InChIKey of sodium;2-methylpropane;hydrate?
The InChIKey is YIQZXHRLCNLNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.Na.H2O/c1-4(2)3;;/h1-3H3;;1H2/q-1;+1;.
What are the key properties of sodium;2-methylpropane;hydrate?
sodium;2-methylpropane;hydrate has a molecular weight of 98.12 g/mol, XLogP of -2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylpropane;hydrate is sourced from PubChem (CID 172863032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).