About 2-methylpropane;silver;sulfanide
2-methylpropane;silver;sulfanide (PubChem CID 174998637) has the molecular formula C4H10AgS-2
and a molecular weight of 198.06 g/mol. Its IUPAC name is 2-methylpropane;silver;sulfanide.
Molecular Properties
| Compound Name | 2-methylpropane;silver;sulfanide |
| PubChem CID | 174998637 |
| Molecular Formula | C4H10AgS-2 |
| Molecular Weight | 198.06 g/mol |
| Exact Mass | 196.96 |
| IUPAC Name | 2-methylpropane;silver;sulfanide |
| SMILES | C[C-](C)C.[Ag].[SH-] |
| InChI | InChI=1S/C4H9.Ag.H2S/c1-4(2)3;;/h1-3H3;;1H2/q-1;;/p-1 |
| InChIKey | WZRLFAUPDSDEEF-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.06 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;silver;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;silver;sulfanide?
The IUPAC name of 2-methylpropane;silver;sulfanide (CID 174998637) is 2-methylpropane;silver;sulfanide.
What is the SMILES notation for 2-methylpropane;silver;sulfanide?
The canonical SMILES for 2-methylpropane;silver;sulfanide is C[C-](C)C.[Ag].[SH-].
What is the InChIKey of 2-methylpropane;silver;sulfanide?
The InChIKey is WZRLFAUPDSDEEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9.Ag.H2S/c1-4(2)3;;/h1-3H3;;1H2/q-1;;/p-1.
What are the key properties of 2-methylpropane;silver;sulfanide?
2-methylpropane;silver;sulfanide has a molecular weight of 198.06 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;silver;sulfanide is sourced from PubChem (CID 174998637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).