C6H5F3N2O3 — CID 152812081
3-hydroxy-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 152812081) has the molecular formula C6H5F3N2O3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-hydroxy-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 152812081 |
| Molecular Formula | C6H5F3N2O3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3-hydroxy-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(O)c1=O |
| InChI | InChI=1S/C6H5F3N2O3/c1-10-3(6(7,8)9)2-4(12)11(14)5(10)13/h2,14H,1H3 |
| InChIKey | SRJCBMCWJUEHIP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|