C19H32O8S2 — CID 152823078
bis(1-formylcyclohexyl) pentane-1,5-disulfonate (PubChem CID 152823078) has the molecular formula C19H32O8S2 and a molecular weight of 452.59 g/mol. Its IUPAC name is bis(1-formylcyclohexyl) pentane-1,5-disulfonate.
| Compound Name | bis(1-formylcyclohexyl) pentane-1,5-disulfonate |
|---|---|
| PubChem CID | 152823078 |
| Molecular Formula | C19H32O8S2 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | bis(1-formylcyclohexyl) pentane-1,5-disulfonate |
| SMILES | O=CC1(OS(=O)(=O)CCCCCS(=O)(=O)OC2(C=O)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C19H32O8S2/c20-16-18(10-4-1-5-11-18)26-28(22,23)14-8-3-9-15-29(24,25)27-19(17-21)12-6-2-7-13-19/h16-17H,1-15H2 |
| InChIKey | SUHCHSYSZJDFHB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|