About (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate
(1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate (PubChem CID 146230763) has the molecular formula C20H32O6
and a molecular weight of 368.47 g/mol. Its IUPAC name is (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate.
Molecular Properties
| Compound Name | (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate |
| PubChem CID | 146230763 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate |
| SMILES | O=CC1(OC(=O)CCCCC(O)OC2(C=O)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C20H32O6/c21-15-19(11-5-1-6-12-19)25-17(23)9-3-4-10-18(24)26-20(16-22)13-7-2-8-14-20/h15-17,23H,1-14H2 |
| InChIKey | DDVQLUUPZNZVRS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate?
The IUPAC name of (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate (CID 146230763) is (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate.
What is the SMILES notation for (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate?
The canonical SMILES for (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate is O=CC1(OC(=O)CCCCC(O)OC2(C=O)CCCCC2)CCCCC1.
What is the InChIKey of (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate?
The InChIKey is DDVQLUUPZNZVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O6/c21-15-19(11-5-1-6-12-19)25-17(23)9-3-4-10-18(24)26-20(16-22)13-7-2-8-14-20/h15-17,23H,1-14H2.
What are the key properties of (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate?
(1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate has a molecular weight of 368.47 g/mol, XLogP of 3.23, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-formylcyclohexyl) 6-(1-formylcyclohexyl)oxy-6-hydroxyhexanoate is sourced from PubChem (CID 146230763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).