About (2-silyloxan-2-yl) dodecanoate
(2-silyloxan-2-yl) dodecanoate (PubChem CID 174613847) has the molecular formula C17H34O3Si
and a molecular weight of 314.54 g/mol. Its IUPAC name is (2-silyloxan-2-yl) dodecanoate.
Molecular Properties
| Compound Name | (2-silyloxan-2-yl) dodecanoate |
| PubChem CID | 174613847 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (2-silyloxan-2-yl) dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OC1([SiH3])CCCCO1 |
| InChI | InChI=1S/C17H34O3Si/c1-2-3-4-5-6-7-8-9-10-13-16(18)20-17(21)14-11-12-15-19-17/h2-15H2,1,21H3 |
| InChIKey | TXVWLGSTNVFDOR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-silyloxan-2-yl) dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-silyloxan-2-yl) dodecanoate?
The IUPAC name of (2-silyloxan-2-yl) dodecanoate (CID 174613847) is (2-silyloxan-2-yl) dodecanoate.
What is the SMILES notation for (2-silyloxan-2-yl) dodecanoate?
The canonical SMILES for (2-silyloxan-2-yl) dodecanoate is CCCCCCCCCCCC(=O)OC1([SiH3])CCCCO1.
What is the InChIKey of (2-silyloxan-2-yl) dodecanoate?
The InChIKey is TXVWLGSTNVFDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3Si/c1-2-3-4-5-6-7-8-9-10-13-16(18)20-17(21)14-11-12-15-19-17/h2-15H2,1,21H3.
What are the key properties of (2-silyloxan-2-yl) dodecanoate?
(2-silyloxan-2-yl) dodecanoate has a molecular weight of 314.54 g/mol, XLogP of 3.67, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-silyloxan-2-yl) dodecanoate is sourced from PubChem (CID 174613847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).