About [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate
[dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate (PubChem CID 175339116) has the molecular formula C25H52O5SiTe
and a molecular weight of 588.37 g/mol. Its IUPAC name is [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate.
Molecular Properties
| Compound Name | [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate |
| PubChem CID | 175339116 |
| Molecular Formula | C25H52O5SiTe |
| Molecular Weight | 588.37 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate |
| SMILES | CCCCCC(=O)O[TeH](CCCC)(CCCC)(OC(=O)CCCCC)C1([SiH3])CCCCO1 |
| InChI | InChI=1S/C25H52O5SiTe/c1-5-9-13-17-23(26)29-32(21-11-7-3,22-12-8-4,25(31)19-15-16-20-28-25)30-24(27)18-14-10-6-2/h32H,5-22H2,1-4,31H3 |
| InChIKey | KVVGQVFKHHFCDY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate?
The IUPAC name of [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate (CID 175339116) is [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate.
What is the SMILES notation for [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate?
The canonical SMILES for [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate is CCCCCC(=O)O[TeH](CCCC)(CCCC)(OC(=O)CCCCC)C1([SiH3])CCCCO1.
What is the InChIKey of [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate?
The InChIKey is KVVGQVFKHHFCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H52O5SiTe/c1-5-9-13-17-23(26)29-32(21-11-7-3,22-12-8-4,25(31)19-15-16-20-28-25)30-24(27)18-14-10-6-2/h32H,5-22H2,1-4,31H3.
What are the key properties of [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate?
[dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate has a molecular weight of 588.37 g/mol, XLogP of 5.76, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [dibutyl-hexanoyloxy-(2-silyloxan-2-yl)-λ6-tellanyl] hexanoate is sourced from PubChem (CID 175339116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).