C10H10N3O2- — CID 152832784
3-(1,3-dimethylpyrazol-4-yl)-2H-pyrrole-5-carboxylate (PubChem CID 152832784) has the molecular formula C10H10N3O2- and a molecular weight of 204.21 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)-2H-pyrrole-5-carboxylate.
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)-2H-pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 152832784 |
| Molecular Formula | C10H10N3O2- |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)-2H-pyrrole-5-carboxylate |
| SMILES | Cc1nn(C)cc1C1=CC(C(=O)[O-])=NC1 |
| InChI | InChI=1S/C10H11N3O2/c1-6-8(5-13(2)12-6)7-3-9(10(14)15)11-4-7/h3,5H,4H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | SWOBQJYNTXTSNE-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |