C19H33N3O — CID 176976548
2-(1,3-dimethylpyrazol-4-yl)-5-methylbenzamide;ethane (PubChem CID 176976548) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-5-methylbenzamide;ethane.
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-5-methylbenzamide;ethane |
|---|---|
| PubChem CID | 176976548 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-5-methylbenzamide;ethane |
| SMILES | CC.CC.CC.Cc1ccc(-c2cn(C)nc2C)c(C(N)=O)c1 |
| InChI | InChI=1S/C13H15N3O.3C2H6/c1-8-4-5-10(11(6-8)13(14)17)12-7-16(3)15-9(12)2;3*1-2/h4-7H,1-3H3,(H2,14,17);3*1-2H3 |
| InChIKey | WIWPPNICCBCICN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |