C15H8N2O8 — CID 15284035
2-methoxycarbonyl-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7,9-dicarboxylic acid (PubChem CID 15284035) has the molecular formula C15H8N2O8 and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-methoxycarbonyl-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7,9-dicarboxylic acid.
| Compound Name | 2-methoxycarbonyl-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7,9-dicarboxylic acid |
|---|---|
| PubChem CID | 15284035 |
| Molecular Formula | C15H8N2O8 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-methoxycarbonyl-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7,9-dicarboxylic acid |
| SMILES | COC(=O)c1cc2c([nH]1)-c1c(C(=O)O)cc(C(=O)O)nc1C(=O)C2=O |
| InChI | InChI=1S/C15H8N2O8/c1-25-15(24)7-3-5-9(17-7)8-4(13(20)21)2-6(14(22)23)16-10(8)12(19)11(5)18/h2-3,17H,1H3,(H,20,21)(H,22,23) |
| InChIKey | NJCCAUCJPFFUJE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|