C12H9Cl3N2O2 — CID 15284861
(2,4,6-trichlorophenyl) 2-imidazol-1-ylpropanoate (PubChem CID 15284861) has the molecular formula C12H9Cl3N2O2 and a molecular weight of 319.58 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-imidazol-1-ylpropanoate.
| Compound Name | (2,4,6-trichlorophenyl) 2-imidazol-1-ylpropanoate |
|---|---|
| PubChem CID | 15284861 |
| Molecular Formula | C12H9Cl3N2O2 |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-imidazol-1-ylpropanoate |
| SMILES | CC(C(=O)Oc1c(Cl)cc(Cl)cc1Cl)n1ccnc1 |
| InChI | InChI=1S/C12H9Cl3N2O2/c1-7(17-3-2-16-6-17)12(18)19-11-9(14)4-8(13)5-10(11)15/h2-7H,1H3 |
| InChIKey | RVKQHOMTWVIZGR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|