C14H14Cl2N2OS — CID 21294312
S-methyl 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioate (PubChem CID 21294312) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is S-methyl 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioate.
| Compound Name | S-methyl 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioate |
|---|---|
| PubChem CID | 21294312 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | S-methyl 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioate |
| SMILES | CSC(=O)C(C(C)c1ccc(Cl)cc1Cl)n1ccnc1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-9(11-4-3-10(15)7-12(11)16)13(14(19)20-2)18-6-5-17-8-18/h3-9,13H,1-2H3 |
| InChIKey | IBZHNDSIBBEBED-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|