C13H12Cl2N2OS — CID 88521711
3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioic S-acid (PubChem CID 88521711) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioic S-acid.
| Compound Name | 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioic S-acid |
|---|---|
| PubChem CID | 88521711 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-imidazol-1-ylbutanethioic S-acid |
| SMILES | CC(c1ccc(Cl)cc1Cl)C(C(=O)S)n1ccnc1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-8(10-3-2-9(14)6-11(10)15)12(13(18)19)17-5-4-16-7-17/h2-8,12H,1H3,(H,18,19) |
| InChIKey | YFXFCVHBUTUIEU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|