C17H23NOS — CID 152849020
1-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-4,4-dimethylpentane-2-thione (PubChem CID 152849020) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-4,4-dimethylpentane-2-thione.
| Compound Name | 1-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-4,4-dimethylpentane-2-thione |
|---|---|
| PubChem CID | 152849020 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-4,4-dimethylpentane-2-thione |
| SMILES | C=CCc1cccc(/C=N/CC(=S)CC(C)(C)C)c1O |
| InChI | InChI=1S/C17H23NOS/c1-5-7-13-8-6-9-14(16(13)19)11-18-12-15(20)10-17(2,3)4/h5-6,8-9,11,19H,1,7,10,12H2,2-4H3/b18-11+ |
| InChIKey | TUUXHPFICCBEPS-WOJGMQOQSA-N |
| XLogP | 4.35 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|