C20H28O — CID 170777782
2-prop-2-enyl-6-[(E)-2-(2,3,4,5-tetramethylcyclopentyl)ethenyl]phenol (PubChem CID 170777782) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-prop-2-enyl-6-[(E)-2-(2,3,4,5-tetramethylcyclopentyl)ethenyl]phenol.
| Compound Name | 2-prop-2-enyl-6-[(E)-2-(2,3,4,5-tetramethylcyclopentyl)ethenyl]phenol |
|---|---|
| PubChem CID | 170777782 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-prop-2-enyl-6-[(E)-2-(2,3,4,5-tetramethylcyclopentyl)ethenyl]phenol |
| SMILES | C=CCc1cccc(/C=C/C2C(C)C(C)C(C)C2C)c1O |
| InChI | InChI=1S/C20H28O/c1-6-8-17-9-7-10-18(20(17)21)11-12-19-15(4)13(2)14(3)16(19)5/h6-7,9-16,19,21H,1,8H2,2-5H3/b12-11+ |
| InChIKey | USTJJKPNVUDHHV-VAWYXSNFSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|