About 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea
1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea (PubChem CID 15285317) has the molecular formula C25H22Cl2N2O2
and a molecular weight of 453.37 g/mol. Its IUPAC name is 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea.
Molecular Properties
| Compound Name | 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea |
| PubChem CID | 15285317 |
| Molecular Formula | C25H22Cl2N2O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1oc2ccc(Cl)cc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C25H22Cl2N2O2/c1-3-15-8-7-9-16(4-2)23(15)28-25(30)29-24-22(18-10-5-6-11-20(18)27)19-14-17(26)12-13-21(19)31-24/h5-14H,3-4H2,1-2H3,(H2,28,29,30) |
| InChIKey | DPJBWTJPNLWSAN-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
The IUPAC name of 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea (CID 15285317) is 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea.
What is the SMILES notation for 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
The canonical SMILES for 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea is CCc1cccc(CC)c1NC(=O)Nc1oc2ccc(Cl)cc2c1-c1ccccc1Cl.
What is the InChIKey of 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
The InChIKey is DPJBWTJPNLWSAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22Cl2N2O2/c1-3-15-8-7-9-16(4-2)23(15)28-25(30)29-24-22(18-10-5-6-11-20(18)27)19-14-17(26)12-13-21(19)31-24/h5-14H,3-4H2,1-2H3,(H2,28,29,30).
What are the key properties of 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea has a molecular weight of 453.37 g/mol, XLogP of 8.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea is sourced from PubChem (CID 15285317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).