C25H22Cl2N2O2 — CID 15285317
1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea (PubChem CID 15285317) has the molecular formula C25H22Cl2N2O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea.
| Compound Name | 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea |
|---|---|
| PubChem CID | 15285317 |
| Molecular Formula | C25H22Cl2N2O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[5-chloro-3-(2-chlorophenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1oc2ccc(Cl)cc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C25H22Cl2N2O2/c1-3-15-8-7-9-16(4-2)23(15)28-25(30)29-24-22(18-10-5-6-11-20(18)27)19-14-17(26)12-13-21(19)31-24/h5-14H,3-4H2,1-2H3,(H2,28,29,30) |
| InChIKey | DPJBWTJPNLWSAN-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |