About 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea
1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea (PubChem CID 18688796) has the molecular formula C26H25ClN2O2S
and a molecular weight of 465.02 g/mol. Its IUPAC name is 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea.
Molecular Properties
| Compound Name | 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea |
| PubChem CID | 18688796 |
| Molecular Formula | C26H25ClN2O2S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1oc2ccc(Cl)cc2c1-c1ccccc1SC |
| InChI | InChI=1S/C26H25ClN2O2S/c1-4-16-9-8-10-17(5-2)24(16)28-26(30)29-25-23(19-11-6-7-12-22(19)32-3)20-15-18(27)13-14-21(20)31-25/h6-15H,4-5H2,1-3H3,(H2,28,29,30) |
| InChIKey | IYYVIYPOOSYQNY-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
The IUPAC name of 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea (CID 18688796) is 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea.
What is the SMILES notation for 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
The canonical SMILES for 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea is CCc1cccc(CC)c1NC(=O)Nc1oc2ccc(Cl)cc2c1-c1ccccc1SC.
What is the InChIKey of 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
The InChIKey is IYYVIYPOOSYQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25ClN2O2S/c1-4-16-9-8-10-17(5-2)24(16)28-26(30)29-25-23(19-11-6-7-12-22(19)32-3)20-15-18(27)13-14-21(20)31-25/h6-15H,4-5H2,1-3H3,(H2,28,29,30).
What are the key properties of 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea?
1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea has a molecular weight of 465.02 g/mol, XLogP of 8.24, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-chloro-3-(2-methylsulfanylphenyl)-1-benzofuran-2-yl]-3-(2,6-diethylphenyl)urea is sourced from PubChem (CID 18688796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).