C8H16N2 — CID 152857393
(Z)-4-imino-N,N,3-trimethylpent-2-en-2-amine (PubChem CID 152857393) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (Z)-4-imino-N,N,3-trimethylpent-2-en-2-amine.
| Compound Name | (Z)-4-imino-N,N,3-trimethylpent-2-en-2-amine |
|---|---|
| PubChem CID | 152857393 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (Z)-4-imino-N,N,3-trimethylpent-2-en-2-amine |
| SMILES | [H]/N=C(C)/C(C)=C(/C)N(C)C |
| InChI | InChI=1S/C8H16N2/c1-6(7(2)9)8(3)10(4)5/h9H,1-5H3/b8-6-,9-7+ |
| InChIKey | TWVMWGHDEXLMOB-MKKAVFGOSA-N |
| XLogP | 1.88 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|