C11H17NO3 — CID 15286386
(5S,8S,8aS)-5-but-3-enyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 15286386) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (5S,8S,8aS)-5-but-3-enyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5S,8S,8aS)-5-but-3-enyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 15286386 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (5S,8S,8aS)-5-but-3-enyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C=CCC[C@H]1CC[C@H](O)[C@@H]2COC(=O)N12 |
| InChI | InChI=1S/C11H17NO3/c1-2-3-4-8-5-6-10(13)9-7-15-11(14)12(8)9/h2,8-10,13H,1,3-7H2/t8-,9-,10-/m0/s1 |
| InChIKey | YXZOMWZQXLTGNY-GUBZILKMSA-N |
| XLogP | 1.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|