C9H12ClFN2 — CID 152866593
5-chloro-N,4-diethyl-3-fluoropyridin-2-amine (PubChem CID 152866593) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is 5-chloro-N,4-diethyl-3-fluoropyridin-2-amine.
| Compound Name | 5-chloro-N,4-diethyl-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 152866593 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-chloro-N,4-diethyl-3-fluoropyridin-2-amine |
| SMILES | CCNc1ncc(Cl)c(CC)c1F |
| InChI | InChI=1S/C9H12ClFN2/c1-3-6-7(10)5-13-9(8(6)11)12-4-2/h5H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | TYOVHUXMFFYYOJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |