C20H18F2N2O3 — CID 152871521
4-tert-butyl-N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)benzamide (PubChem CID 152871521) has the molecular formula C20H18F2N2O3 and a molecular weight of 372.37 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)benzamide |
|---|---|
| PubChem CID | 152871521 |
| Molecular Formula | C20H18F2N2O3 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-tert-butyl-N-(2,2-difluoro-7H-[1,3]dioxolo[4,5-f]indol-6-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC2=Nc3cc4c(cc3C2)OC(F)(F)O4)cc1 |
| InChI | InChI=1S/C20H18F2N2O3/c1-19(2,3)13-6-4-11(5-7-13)18(25)24-17-9-12-8-15-16(10-14(12)23-17)27-20(21,22)26-15/h4-8,10H,9H2,1-3H3,(H,23,24,25) |
| InChIKey | TZMQCTNUZVEIBG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |