C22H17N3O5 — CID 15287761
(4-nitrophenyl) 3-oxo-4,5-diphenylpyrazolidine-1-carboxylate (PubChem CID 15287761) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is (4-nitrophenyl) 3-oxo-4,5-diphenylpyrazolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 3-oxo-4,5-diphenylpyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 15287761 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (4-nitrophenyl) 3-oxo-4,5-diphenylpyrazolidine-1-carboxylate |
| SMILES | O=C1NN(C(=O)Oc2ccc([N+](=O)[O-])cc2)C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C22H17N3O5/c26-21-19(15-7-3-1-4-8-15)20(16-9-5-2-6-10-16)24(23-21)22(27)30-18-13-11-17(12-14-18)25(28)29/h1-14,19-20H,(H,23,26) |
| InChIKey | OGVQJQODWNCNNG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|