C26H22ClN3O3S — CID 15288032
2-[5-(1,3-benzothiazol-2-ylmethoxy)-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-hydroxyacetamide (PubChem CID 15288032) has the molecular formula C26H22ClN3O3S and a molecular weight of 492.00 g/mol. Its IUPAC name is 2-[5-(1,3-benzothiazol-2-ylmethoxy)-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[5-(1,3-benzothiazol-2-ylmethoxy)-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 15288032 |
| Molecular Formula | C26H22ClN3O3S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-[5-(1,3-benzothiazol-2-ylmethoxy)-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-hydroxyacetamide |
| SMILES | Cc1c(CC(=O)NO)c2cc(OCc3nc4ccccc4s3)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22ClN3O3S/c1-16-20(13-25(31)29-32)21-12-19(33-15-26-28-22-4-2-3-5-24(22)34-26)10-11-23(21)30(16)14-17-6-8-18(27)9-7-17/h2-12,32H,13-15H2,1H3,(H,29,31) |
| InChIKey | SIJVCRCLWNHKBU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|