C14H16ClF2NO4 — CID 152883929
(2S)-4-[4-amino-5-chloro-2-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxobutanoic acid (PubChem CID 152883929) has the molecular formula C14H16ClF2NO4 and a molecular weight of 335.73 g/mol. Its IUPAC name is (2S)-4-[4-amino-5-chloro-2-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-[4-amino-5-chloro-2-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 152883929 |
| Molecular Formula | C14H16ClF2NO4 |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (2S)-4-[4-amino-5-chloro-2-(difluoromethoxy)phenyl]-2-ethyl-2-methyl-4-oxobutanoic acid |
| SMILES | CC[C@@](C)(CC(=O)c1cc(Cl)c(N)cc1OC(F)F)C(=O)O |
| InChI | InChI=1S/C14H16ClF2NO4/c1-3-14(2,12(20)21)6-10(19)7-4-8(15)9(18)5-11(7)22-13(16)17/h4-5,13H,3,6,18H2,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | UCADVVPWEMYBRP-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|