C31H33N3O2 — CID 152898842
2-(2-amino-5-phenylphenyl)-1-[7-cyclopropyl-1-(2-morpholin-4-ylethyl)indol-5-yl]ethanone (PubChem CID 152898842) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-(2-amino-5-phenylphenyl)-1-[7-cyclopropyl-1-(2-morpholin-4-ylethyl)indol-5-yl]ethanone.
| Compound Name | 2-(2-amino-5-phenylphenyl)-1-[7-cyclopropyl-1-(2-morpholin-4-ylethyl)indol-5-yl]ethanone |
|---|---|
| PubChem CID | 152898842 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-(2-amino-5-phenylphenyl)-1-[7-cyclopropyl-1-(2-morpholin-4-ylethyl)indol-5-yl]ethanone |
| SMILES | Nc1ccc(-c2ccccc2)cc1CC(=O)c1cc(C2CC2)c2c(ccn2CCN2CCOCC2)c1 |
| InChI | InChI=1S/C31H33N3O2/c32-29-9-8-24(22-4-2-1-3-5-22)18-26(29)21-30(35)27-19-25-10-11-34(13-12-33-14-16-36-17-15-33)31(25)28(20-27)23-6-7-23/h1-5,8-11,18-20,23H,6-7,12-17,21,32H2 |
| InChIKey | UEXUSKKTGUQUFO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|